C29H32N2O3 — CID 19243575
1-benzoyl-5-[4-(2,3-dimethylphenoxy)butyl]-3-methyl-2,3-dihydro-1,5-benzodiazepin-4-one (PubChem CID 19243575) has the molecular formula C29H32N2O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is 1-benzoyl-5-[4-(2,3-dimethylphenoxy)butyl]-3-methyl-2,3-dihydro-1,5-benzodiazepin-4-one.
| Compound Name | 1-benzoyl-5-[4-(2,3-dimethylphenoxy)butyl]-3-methyl-2,3-dihydro-1,5-benzodiazepin-4-one |
|---|---|
| PubChem CID | 19243575 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 1-benzoyl-5-[4-(2,3-dimethylphenoxy)butyl]-3-methyl-2,3-dihydro-1,5-benzodiazepin-4-one |
| SMILES | Cc1cccc(OCCCCN2C(=O)C(C)CN(C(=O)c3ccccc3)c3ccccc32)c1C |
| InChI | InChI=1S/C29H32N2O3/c1-21-12-11-17-27(23(21)3)34-19-10-9-18-30-25-15-7-8-16-26(25)31(20-22(2)28(30)32)29(33)24-13-5-4-6-14-24/h4-8,11-17,22H,9-10,18-20H2,1-3H3 |
| InChIKey | FIWAUUSFIODDCB-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|