C18H17N3O2 — CID 19244494
N-[4-(2,5-dimethylphenyl)-1,2,5-oxadiazol-3-yl]-2-methylbenzamide (PubChem CID 19244494) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is N-[4-(2,5-dimethylphenyl)-1,2,5-oxadiazol-3-yl]-2-methylbenzamide.
| Compound Name | N-[4-(2,5-dimethylphenyl)-1,2,5-oxadiazol-3-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 19244494 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | N-[4-(2,5-dimethylphenyl)-1,2,5-oxadiazol-3-yl]-2-methylbenzamide |
| SMILES | Cc1ccc(C)c(-c2nonc2NC(=O)c2ccccc2C)c1 |
| InChI | InChI=1S/C18H17N3O2/c1-11-8-9-13(3)15(10-11)16-17(21-23-20-16)19-18(22)14-7-5-4-6-12(14)2/h4-10H,1-3H3,(H,19,21,22) |
| InChIKey | DDEUNFSPSFCFNH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |