C23H27N3O3 — CID 19244743
3-butoxy-N-[4-(2,5-diethylphenyl)-1,2,5-oxadiazol-3-yl]benzamide (PubChem CID 19244743) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 3-butoxy-N-[4-(2,5-diethylphenyl)-1,2,5-oxadiazol-3-yl]benzamide.
| Compound Name | 3-butoxy-N-[4-(2,5-diethylphenyl)-1,2,5-oxadiazol-3-yl]benzamide |
|---|---|
| PubChem CID | 19244743 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 3-butoxy-N-[4-(2,5-diethylphenyl)-1,2,5-oxadiazol-3-yl]benzamide |
| SMILES | CCCCOc1cccc(C(=O)Nc2nonc2-c2cc(CC)ccc2CC)c1 |
| InChI | InChI=1S/C23H27N3O3/c1-4-7-13-28-19-10-8-9-18(15-19)23(27)24-22-21(25-29-26-22)20-14-16(5-2)11-12-17(20)6-3/h8-12,14-15H,4-7,13H2,1-3H3,(H,24,26,27) |
| InChIKey | FAGJWDACGUHEPR-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|