C12H16N2OS — CID 19245053
3-tert-butyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-one (PubChem CID 19245053) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is 3-tert-butyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-tert-butyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 19245053 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 3-tert-butyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2ncn(C(C)(C)C)c(=O)c2c1C |
| InChI | InChI=1S/C12H16N2OS/c1-7-8(2)16-10-9(7)11(15)14(6-13-10)12(3,4)5/h6H,1-5H3 |
| InChIKey | FCEXVAXCKMWPTQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |