C10H16N2O — CID 19245291
3,6,6-trimethyl-2,4,5,7-tetrahydroindazol-4-ol (PubChem CID 19245291) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 3,6,6-trimethyl-2,4,5,7-tetrahydroindazol-4-ol.
| Compound Name | 3,6,6-trimethyl-2,4,5,7-tetrahydroindazol-4-ol |
|---|---|
| PubChem CID | 19245291 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 3,6,6-trimethyl-2,4,5,7-tetrahydroindazol-4-ol |
| SMILES | Cc1[nH]nc2c1C(O)CC(C)(C)C2 |
| InChI | InChI=1S/C10H16N2O/c1-6-9-7(12-11-6)4-10(2,3)5-8(9)13/h8,13H,4-5H2,1-3H3,(H,11,12) |
| InChIKey | GBXIUCRUYNBLER-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |