C22H19N3O4S2 — CID 19246243
(2E,5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(Z)-thiophen-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 19246243) has the molecular formula C22H19N3O4S2 and a molecular weight of 453.55 g/mol. Its IUPAC name is (2E,5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(Z)-thiophen-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(Z)-thiophen-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 19246243 |
| Molecular Formula | C22H19N3O4S2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | (2E,5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(Z)-thiophen-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/C=C2\S/C(=N/N=C\c3cccs3)N(Cc3ccco3)C2=O)cc1OC |
| InChI | InChI=1S/C22H19N3O4S2/c1-27-18-8-7-15(11-19(18)28-2)12-20-21(26)25(14-16-5-3-9-29-16)22(31-20)24-23-13-17-6-4-10-30-17/h3-13H,14H2,1-2H3/b20-12-,23-13-,24-22+ |
| InChIKey | DPRFKGOSIUAWGL-ZUYYYZHBSA-N |
| XLogP | 4.86 |
| TPSA | 76.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|