C31H28N4O4S2 — CID 19249141
2-[(1R,8R,9R)-8-[4-(dimethylamino)phenyl]-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide (PubChem CID 19249141) has the molecular formula C31H28N4O4S2 and a molecular weight of 584.72 g/mol. Its IUPAC name is 2-[(1R,8R,9R)-8-[4-(dimethylamino)phenyl]-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[(1R,8R,9R)-8-[4-(dimethylamino)phenyl]-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 19249141 |
| Molecular Formula | C31H28N4O4S2 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | 2-[(1R,8R,9R)-8-[4-(dimethylamino)phenyl]-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2c3c(sc2=O)[C@@H](c2ccc(N(C)C)cc2)[C@@H]2C(=O)N(c4ccccc4)C(=O)[C@@H]2S3)cc1 |
| InChI | InChI=1S/C31H28N4O4S2/c1-18-9-13-20(14-10-18)32-23(36)17-34-30-27(41-31(34)39)24(19-11-15-21(16-12-19)33(2)3)25-26(40-30)29(38)35(28(25)37)22-7-5-4-6-8-22/h4-16,24-26H,17H2,1-3H3,(H,32,36)/t24-,25-,26+/m0/s1 |
| InChIKey | OKTIFMSPYDGOOP-KKUQBAQOSA-N |
| XLogP | 4.72 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|