C29H22ClN3O5S2 — CID 19254204
2-[3-[(1R,8R,9R)-11-(4-chlorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 19254204) has the molecular formula C29H22ClN3O5S2 and a molecular weight of 592.10 g/mol. Its IUPAC name is 2-[3-[(1R,8R,9R)-11-(4-chlorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[3-[(1R,8R,9R)-11-(4-chlorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 19254204 |
| Molecular Formula | C29H22ClN3O5S2 |
| Molecular Weight | 592.10 g/mol |
| Exact Mass | 591.07 |
| IUPAC Name | 2-[3-[(1R,8R,9R)-11-(4-chlorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2cccc([C@@H]3c4sc(=O)[nH]c4S[C@H]4C(=O)N(c5ccc(Cl)cc5)C(=O)[C@@H]34)c2)cc1 |
| InChI | InChI=1S/C29H22ClN3O5S2/c1-15-5-9-18(10-6-15)31-21(34)14-38-20-4-2-3-16(13-20)22-23-25(39-26-24(22)40-29(37)32-26)28(36)33(27(23)35)19-11-7-17(30)8-12-19/h2-13,22-23,25H,14H2,1H3,(H,31,34)(H,32,37)/t22-,23-,25+/m0/s1 |
| InChIKey | PXOJVGMSKNAISD-SONWIMMPSA-N |
| XLogP | 5.21 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.10 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|