About bis((5-aminobenzo[a]phenoxazin-9-ylidene)-diethylazanium);sulfate
bis((5-aminobenzo[a]phenoxazin-9-ylidene)-diethylazanium);sulfate (PubChem CID 19256) has the molecular formula C40H40N6O6S
and a molecular weight of 732.86 g/mol. Its IUPAC name is bis((5-aminobenzo[a]phenoxazin-9-ylidene)-diethylazanium);sulfate.
Molecular Properties
| Compound Name | bis((5-aminobenzo[a]phenoxazin-9-ylidene)-diethylazanium);sulfate |
| PubChem CID | 19256 |
| Molecular Formula | C40H40N6O6S |
| Molecular Weight | 732.86 g/mol |
| Exact Mass | 732.27 |
| IUPAC Name | bis((5-aminobenzo[a]phenoxazin-9-ylidene)-diethylazanium);sulfate |
| SMILES | CC[N+](CC)=c1ccc2nc3c(cc(N)c4ccccc43)oc-2c1.CC[N+](CC)=c1ccc2nc3c(cc(N)c4ccccc43)oc-2c1.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C20H19N3O.H2O4S/c2*1-3-23(4-2)13-9-10-17-18(11-13)24-19-12-16(21)14-7-5-6-8-15(14)20(19)22-17;1-5(2,3)4/h2*5-12,21H,3-4H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | QIRDPEPUXNCOLD-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 190.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 732.86 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze bis((5-aminobenzo[a]phenoxazin-9-ylidene)-diethylazanium);sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((5-aminobenzo[a]phenoxazin-9-ylidene)-diethylazanium);sulfate?
The IUPAC name of bis((5-aminobenzo[a]phenoxazin-9-ylidene)-diethylazanium);sulfate (CID 19256) is bis((5-aminobenzo[a]phenoxazin-9-ylidene)-diethylazanium);sulfate.
What is the SMILES notation for bis((5-aminobenzo[a]phenoxazin-9-ylidene)-diethylazanium);sulfate?
The canonical SMILES for bis((5-aminobenzo[a]phenoxazin-9-ylidene)-diethylazanium);sulfate is CC[N+](CC)=c1ccc2nc3c(cc(N)c4ccccc43)oc-2c1.CC[N+](CC)=c1ccc2nc3c(cc(N)c4ccccc43)oc-2c1.O=S(=O)([O-])[O-].
What is the InChIKey of bis((5-aminobenzo[a]phenoxazin-9-ylidene)-diethylazanium);sulfate?
The InChIKey is QIRDPEPUXNCOLD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C20H19N3O.H2O4S/c2*1-3-23(4-2)13-9-10-17-18(11-13)24-19-12-16(21)14-7-5-6-8-15(14)20(19)22-17;1-5(2,3)4/h2*5-12,21H,3-4H2,1-2H3;(H2,1,2,3,4).
What are the key properties of bis((5-aminobenzo[a]phenoxazin-9-ylidene)-diethylazanium);sulfate?
bis((5-aminobenzo[a]phenoxazin-9-ylidene)-diethylazanium);sulfate has a molecular weight of 732.86 g/mol, XLogP of 5.62, 4 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis((5-aminobenzo[a]phenoxazin-9-ylidene)-diethylazanium);sulfate is sourced from PubChem (CID 19256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).