C22H20N4O3 — CID 19256900
7-(3,4-dimethoxyphenyl)-5-(3-methoxyphenyl)pyrido[2,3-d]pyrimidin-4-amine (PubChem CID 19256900) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is 7-(3,4-dimethoxyphenyl)-5-(3-methoxyphenyl)pyrido[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-(3,4-dimethoxyphenyl)-5-(3-methoxyphenyl)pyrido[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 19256900 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 7-(3,4-dimethoxyphenyl)-5-(3-methoxyphenyl)pyrido[2,3-d]pyrimidin-4-amine |
| SMILES | COc1cccc(-c2cc(-c3ccc(OC)c(OC)c3)nc3ncnc(N)c23)c1 |
| InChI | InChI=1S/C22H20N4O3/c1-27-15-6-4-5-13(9-15)16-11-17(26-22-20(16)21(23)24-12-25-22)14-7-8-18(28-2)19(10-14)29-3/h4-12H,1-3H3,(H2,23,24,25,26) |
| InChIKey | HKNGLPXZHFAIPH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 92.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |