C22H20N2O3S — CID 19257347
3-(2-methyl-2,3-dihydroindole-1-carbonyl)-N-phenylbenzenesulfonamide (PubChem CID 19257347) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is 3-(2-methyl-2,3-dihydroindole-1-carbonyl)-N-phenylbenzenesulfonamide.
| Compound Name | 3-(2-methyl-2,3-dihydroindole-1-carbonyl)-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 19257347 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 3-(2-methyl-2,3-dihydroindole-1-carbonyl)-N-phenylbenzenesulfonamide |
| SMILES | CC1Cc2ccccc2N1C(=O)c1cccc(S(=O)(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C22H20N2O3S/c1-16-14-17-8-5-6-13-21(17)24(16)22(25)18-9-7-12-20(15-18)28(26,27)23-19-10-3-2-4-11-19/h2-13,15-16,23H,14H2,1H3 |
| InChIKey | VETMQONRLXYJFY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |