C17H17Cl2N3O3S — CID 19257517
2,4-dichloro-5-(cyclopentylsulfamoyl)-N-pyridin-3-ylbenzamide (PubChem CID 19257517) has the molecular formula C17H17Cl2N3O3S and a molecular weight of 414.31 g/mol. Its IUPAC name is 2,4-dichloro-5-(cyclopentylsulfamoyl)-N-pyridin-3-ylbenzamide.
| Compound Name | 2,4-dichloro-5-(cyclopentylsulfamoyl)-N-pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 19257517 |
| Molecular Formula | C17H17Cl2N3O3S |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 2,4-dichloro-5-(cyclopentylsulfamoyl)-N-pyridin-3-ylbenzamide |
| SMILES | O=C(Nc1cccnc1)c1cc(S(=O)(=O)NC2CCCC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H17Cl2N3O3S/c18-14-9-15(19)16(26(24,25)22-11-4-1-2-5-11)8-13(14)17(23)21-12-6-3-7-20-10-12/h3,6-11,22H,1-2,4-5H2,(H,21,23) |
| InChIKey | JGKFZOURBJVVBD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |