C22H31N3O6S2 — CID 19257784
N-[4-(butylsulfamoyl)phenyl]-5-(diethylsulfamoyl)-2-methoxybenzamide (PubChem CID 19257784) has the molecular formula C22H31N3O6S2 and a molecular weight of 497.64 g/mol. Its IUPAC name is N-[4-(butylsulfamoyl)phenyl]-5-(diethylsulfamoyl)-2-methoxybenzamide.
| Compound Name | N-[4-(butylsulfamoyl)phenyl]-5-(diethylsulfamoyl)-2-methoxybenzamide |
|---|---|
| PubChem CID | 19257784 |
| Molecular Formula | C22H31N3O6S2 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | N-[4-(butylsulfamoyl)phenyl]-5-(diethylsulfamoyl)-2-methoxybenzamide |
| SMILES | CCCCNS(=O)(=O)c1ccc(NC(=O)c2cc(S(=O)(=O)N(CC)CC)ccc2OC)cc1 |
| InChI | InChI=1S/C22H31N3O6S2/c1-5-8-15-23-32(27,28)18-11-9-17(10-12-18)24-22(26)20-16-19(13-14-21(20)31-4)33(29,30)25(6-2)7-3/h9-14,16,23H,5-8,15H2,1-4H3,(H,24,26) |
| InChIKey | HLDYBWXQWWVAFV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|