C23H25N5O5S — CID 19258218
N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-4-(4-formylpiperazin-1-yl)sulfonylbenzamide (PubChem CID 19258218) has the molecular formula C23H25N5O5S and a molecular weight of 483.55 g/mol. Its IUPAC name is N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-4-(4-formylpiperazin-1-yl)sulfonylbenzamide.
| Compound Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-4-(4-formylpiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 19258218 |
| Molecular Formula | C23H25N5O5S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-4-(4-formylpiperazin-1-yl)sulfonylbenzamide |
| SMILES | Cc1c(NC(=O)c2ccc(S(=O)(=O)N3CCN(C=O)CC3)cc2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C23H25N5O5S/c1-17-21(23(31)28(25(17)2)19-6-4-3-5-7-19)24-22(30)18-8-10-20(11-9-18)34(32,33)27-14-12-26(16-29)13-15-27/h3-11,16H,12-15H2,1-2H3,(H,24,30) |
| InChIKey | JCQPIZZJYHRRFS-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 113.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|