About N-ethyl-2,7-dimethyl-N-(3-methylphenyl)-1,8-naphthyridin-4-amine
N-ethyl-2,7-dimethyl-N-(3-methylphenyl)-1,8-naphthyridin-4-amine (PubChem CID 19258537) has the molecular formula C19H21N3
and a molecular weight of 291.40 g/mol. Its IUPAC name is N-ethyl-2,7-dimethyl-N-(3-methylphenyl)-1,8-naphthyridin-4-amine.
Molecular Properties
| Compound Name | N-ethyl-2,7-dimethyl-N-(3-methylphenyl)-1,8-naphthyridin-4-amine |
| PubChem CID | 19258537 |
| Molecular Formula | C19H21N3 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | N-ethyl-2,7-dimethyl-N-(3-methylphenyl)-1,8-naphthyridin-4-amine |
| SMILES | CCN(c1cccc(C)c1)c1cc(C)nc2nc(C)ccc12 |
| InChI | InChI=1S/C19H21N3/c1-5-22(16-8-6-7-13(2)11-16)18-12-15(4)21-19-17(18)10-9-14(3)20-19/h6-12H,5H2,1-4H3 |
| InChIKey | NNWIZDCXXCIAEH-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-2,7-dimethyl-N-(3-methylphenyl)-1,8-naphthyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2,7-dimethyl-N-(3-methylphenyl)-1,8-naphthyridin-4-amine?
The IUPAC name of N-ethyl-2,7-dimethyl-N-(3-methylphenyl)-1,8-naphthyridin-4-amine (CID 19258537) is N-ethyl-2,7-dimethyl-N-(3-methylphenyl)-1,8-naphthyridin-4-amine.
What is the SMILES notation for N-ethyl-2,7-dimethyl-N-(3-methylphenyl)-1,8-naphthyridin-4-amine?
The canonical SMILES for N-ethyl-2,7-dimethyl-N-(3-methylphenyl)-1,8-naphthyridin-4-amine is CCN(c1cccc(C)c1)c1cc(C)nc2nc(C)ccc12.
What is the InChIKey of N-ethyl-2,7-dimethyl-N-(3-methylphenyl)-1,8-naphthyridin-4-amine?
The InChIKey is NNWIZDCXXCIAEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3/c1-5-22(16-8-6-7-13(2)11-16)18-12-15(4)21-19-17(18)10-9-14(3)20-19/h6-12H,5H2,1-4H3.
What are the key properties of N-ethyl-2,7-dimethyl-N-(3-methylphenyl)-1,8-naphthyridin-4-amine?
N-ethyl-2,7-dimethyl-N-(3-methylphenyl)-1,8-naphthyridin-4-amine has a molecular weight of 291.40 g/mol, XLogP of 4.71, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2,7-dimethyl-N-(3-methylphenyl)-1,8-naphthyridin-4-amine is sourced from PubChem (CID 19258537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).