About ethyl (3Z)-3-[acetyl(1,3-benzothiazol-2-yl)hydrazinylidene]-3-(2-methylphenyl)propanoate
ethyl (3Z)-3-[acetyl(1,3-benzothiazol-2-yl)hydrazinylidene]-3-(2-methylphenyl)propanoate (PubChem CID 19259120) has the molecular formula C21H21N3O3S
and a molecular weight of 395.48 g/mol. Its IUPAC name is ethyl (3Z)-3-[acetyl(1,3-benzothiazol-2-yl)hydrazinylidene]-3-(2-methylphenyl)propanoate.
Molecular Properties
| Compound Name | ethyl (3Z)-3-[acetyl(1,3-benzothiazol-2-yl)hydrazinylidene]-3-(2-methylphenyl)propanoate |
| PubChem CID | 19259120 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | ethyl (3Z)-3-[acetyl(1,3-benzothiazol-2-yl)hydrazinylidene]-3-(2-methylphenyl)propanoate |
| SMILES | CCOC(=O)C/C(=N/N(C(C)=O)c1nc2ccccc2s1)c1ccccc1C |
| InChI | InChI=1S/C21H21N3O3S/c1-4-27-20(26)13-18(16-10-6-5-9-14(16)2)23-24(15(3)25)21-22-17-11-7-8-12-19(17)28-21/h5-12H,4,13H2,1-3H3/b23-18- |
| InChIKey | JMAUTTPOPQUHCZ-NKFKGCMQSA-N |
| XLogP | 4.32 |
| TPSA | 71.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl (3Z)-3-[acetyl(1,3-benzothiazol-2-yl)hydrazinylidene]-3-(2-methylphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3Z)-3-[acetyl(1,3-benzothiazol-2-yl)hydrazinylidene]-3-(2-methylphenyl)propanoate?
The IUPAC name of ethyl (3Z)-3-[acetyl(1,3-benzothiazol-2-yl)hydrazinylidene]-3-(2-methylphenyl)propanoate (CID 19259120) is ethyl (3Z)-3-[acetyl(1,3-benzothiazol-2-yl)hydrazinylidene]-3-(2-methylphenyl)propanoate.
What is the SMILES notation for ethyl (3Z)-3-[acetyl(1,3-benzothiazol-2-yl)hydrazinylidene]-3-(2-methylphenyl)propanoate?
The canonical SMILES for ethyl (3Z)-3-[acetyl(1,3-benzothiazol-2-yl)hydrazinylidene]-3-(2-methylphenyl)propanoate is CCOC(=O)C/C(=N/N(C(C)=O)c1nc2ccccc2s1)c1ccccc1C.
What is the InChIKey of ethyl (3Z)-3-[acetyl(1,3-benzothiazol-2-yl)hydrazinylidene]-3-(2-methylphenyl)propanoate?
The InChIKey is JMAUTTPOPQUHCZ-NKFKGCMQSA-N. The full InChI is InChI=1S/C21H21N3O3S/c1-4-27-20(26)13-18(16-10-6-5-9-14(16)2)23-24(15(3)25)21-22-17-11-7-8-12-19(17)28-21/h5-12H,4,13H2,1-3H3/b23-18-.
What are the key properties of ethyl (3Z)-3-[acetyl(1,3-benzothiazol-2-yl)hydrazinylidene]-3-(2-methylphenyl)propanoate?
ethyl (3Z)-3-[acetyl(1,3-benzothiazol-2-yl)hydrazinylidene]-3-(2-methylphenyl)propanoate has a molecular weight of 395.48 g/mol, XLogP of 4.32, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3Z)-3-[acetyl(1,3-benzothiazol-2-yl)hydrazinylidene]-3-(2-methylphenyl)propanoate is sourced from PubChem (CID 19259120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).