C18H18N2O5S — CID 19259782
3-benzyl-6-morpholin-4-ylsulfonyl-1,3-benzoxazol-2-one (PubChem CID 19259782) has the molecular formula C18H18N2O5S and a molecular weight of 374.42 g/mol. Its IUPAC name is 3-benzyl-6-morpholin-4-ylsulfonyl-1,3-benzoxazol-2-one.
| Compound Name | 3-benzyl-6-morpholin-4-ylsulfonyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 19259782 |
| Molecular Formula | C18H18N2O5S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 3-benzyl-6-morpholin-4-ylsulfonyl-1,3-benzoxazol-2-one |
| SMILES | O=c1oc2cc(S(=O)(=O)N3CCOCC3)ccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C18H18N2O5S/c21-18-20(13-14-4-2-1-3-5-14)16-7-6-15(12-17(16)25-18)26(22,23)19-8-10-24-11-9-19/h1-7,12H,8-11,13H2 |
| InChIKey | DEJRVUXIOFHEID-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 81.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |