About 9-ethenylxanthen-9-ol
9-ethenylxanthen-9-ol (PubChem CID 19261468) has the molecular formula C15H12O2
and a molecular weight of 224.26 g/mol. Its IUPAC name is 9-ethenylxanthen-9-ol.
Molecular Properties
| Compound Name | 9-ethenylxanthen-9-ol |
| PubChem CID | 19261468 |
| Molecular Formula | C15H12O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 9-ethenylxanthen-9-ol |
| SMILES | C=CC1(O)c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C15H12O2/c1-2-15(16)11-7-3-5-9-13(11)17-14-10-6-4-8-12(14)15/h2-10,16H,1H2 |
| InChIKey | MUYYIQLBDFTVGE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-ethenylxanthen-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethenylxanthen-9-ol?
The IUPAC name of 9-ethenylxanthen-9-ol (CID 19261468) is 9-ethenylxanthen-9-ol.
What is the SMILES notation for 9-ethenylxanthen-9-ol?
The canonical SMILES for 9-ethenylxanthen-9-ol is C=CC1(O)c2ccccc2Oc2ccccc21.
What is the InChIKey of 9-ethenylxanthen-9-ol?
The InChIKey is MUYYIQLBDFTVGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O2/c1-2-15(16)11-7-3-5-9-13(11)17-14-10-6-4-8-12(14)15/h2-10,16H,1H2.
What are the key properties of 9-ethenylxanthen-9-ol?
9-ethenylxanthen-9-ol has a molecular weight of 224.26 g/mol, XLogP of 3.21, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethenylxanthen-9-ol is sourced from PubChem (CID 19261468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).