C33H24O2 — CID 19261667
ethyl 3,3-bis[4-(2-phenylethynyl)phenyl]prop-2-enoate (PubChem CID 19261667) has the molecular formula C33H24O2 and a molecular weight of 452.55 g/mol. Its IUPAC name is ethyl 3,3-bis[4-(2-phenylethynyl)phenyl]prop-2-enoate.
| Compound Name | ethyl 3,3-bis[4-(2-phenylethynyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 19261667 |
| Molecular Formula | C33H24O2 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | ethyl 3,3-bis[4-(2-phenylethynyl)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=C(c1ccc(C#Cc2ccccc2)cc1)c1ccc(C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C33H24O2/c1-2-35-33(34)25-32(30-21-17-28(18-22-30)15-13-26-9-5-3-6-10-26)31-23-19-29(20-24-31)16-14-27-11-7-4-8-12-27/h3-12,17-25H,2H2,1H3 |
| InChIKey | YPXQJJBPHQVGHH-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|