C10H12OS — CID 19261834
2,3,4,5-tetrahydro-1-benzothiepin-7-ol (PubChem CID 19261834) has the molecular formula C10H12OS and a molecular weight of 180.27 g/mol. Its IUPAC name is 2,3,4,5-tetrahydro-1-benzothiepin-7-ol.
| Compound Name | 2,3,4,5-tetrahydro-1-benzothiepin-7-ol |
|---|---|
| PubChem CID | 19261834 |
| Molecular Formula | C10H12OS |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 2,3,4,5-tetrahydro-1-benzothiepin-7-ol |
| SMILES | Oc1ccc2c(c1)CCCCS2 |
| InChI | InChI=1S/C10H12OS/c11-9-4-5-10-8(7-9)3-1-2-6-12-10/h4-5,7,11H,1-3,6H2 |
| InChIKey | GPJAACTVXYGJNZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |