C17H17ClIN5O — CID 19262072
N-[1-[(3-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-4-iodo-1-methylpyrazole-3-carboxamide (PubChem CID 19262072) has the molecular formula C17H17ClIN5O and a molecular weight of 469.71 g/mol. Its IUPAC name is N-[1-[(3-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-4-iodo-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[1-[(3-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-4-iodo-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19262072 |
| Molecular Formula | C17H17ClIN5O |
| Molecular Weight | 469.71 g/mol |
| Exact Mass | 469.02 |
| IUPAC Name | N-[1-[(3-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-4-iodo-1-methylpyrazole-3-carboxamide |
| SMILES | Cc1nn(Cc2cccc(Cl)c2)c(C)c1NC(=O)c1nn(C)cc1I |
| InChI | InChI=1S/C17H17ClIN5O/c1-10-15(20-17(25)16-14(19)9-23(3)22-16)11(2)24(21-10)8-12-5-4-6-13(18)7-12/h4-7,9H,8H2,1-3H3,(H,20,25) |
| InChIKey | ZKKGWPMOGPSFDS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.71 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|