C17H18IN5O2 — CID 19262102
N-[1-[(4-ethylphenoxy)methyl]pyrazol-4-yl]-4-iodo-1-methylpyrazole-3-carboxamide (PubChem CID 19262102) has the molecular formula C17H18IN5O2 and a molecular weight of 451.27 g/mol. Its IUPAC name is N-[1-[(4-ethylphenoxy)methyl]pyrazol-4-yl]-4-iodo-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[1-[(4-ethylphenoxy)methyl]pyrazol-4-yl]-4-iodo-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19262102 |
| Molecular Formula | C17H18IN5O2 |
| Molecular Weight | 451.27 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | N-[1-[(4-ethylphenoxy)methyl]pyrazol-4-yl]-4-iodo-1-methylpyrazole-3-carboxamide |
| SMILES | CCc1ccc(OCn2cc(NC(=O)c3nn(C)cc3I)cn2)cc1 |
| InChI | InChI=1S/C17H18IN5O2/c1-3-12-4-6-14(7-5-12)25-11-23-9-13(8-19-23)20-17(24)16-15(18)10-22(2)21-16/h4-10H,3,11H2,1-2H3,(H,20,24) |
| InChIKey | YZQMTLPGXCQNMU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|