C8H13N3O — CID 19262384
N,1-diethylpyrazole-3-carboxamide (PubChem CID 19262384) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is N,1-diethylpyrazole-3-carboxamide.
| Compound Name | N,1-diethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19262384 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | N,1-diethylpyrazole-3-carboxamide |
| SMILES | CCNC(=O)c1ccn(CC)n1 |
| InChI | InChI=1S/C8H13N3O/c1-3-9-8(12)7-5-6-11(4-2)10-7/h5-6H,3-4H2,1-2H3,(H,9,12) |
| InChIKey | XYQLAQIVFGJNOU-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |