C16H16IN5O — CID 19264112
4-iodo-1-methyl-N-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]pyrazole-3-carboxamide (PubChem CID 19264112) has the molecular formula C16H16IN5O and a molecular weight of 421.24 g/mol. Its IUPAC name is 4-iodo-1-methyl-N-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]pyrazole-3-carboxamide.
| Compound Name | 4-iodo-1-methyl-N-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19264112 |
| Molecular Formula | C16H16IN5O |
| Molecular Weight | 421.24 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | 4-iodo-1-methyl-N-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]pyrazole-3-carboxamide |
| SMILES | Cc1ccccc1Cn1ccc(NC(=O)c2nn(C)cc2I)n1 |
| InChI | InChI=1S/C16H16IN5O/c1-11-5-3-4-6-12(11)9-22-8-7-14(19-22)18-16(23)15-13(17)10-21(2)20-15/h3-8,10H,9H2,1-2H3,(H,18,19,23) |
| InChIKey | BNKTXQVZEYJGMK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|