C14H17BrClN5O2 — CID 19264241
4-[[1-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]pyrazole-3-carbonyl]amino]butanoyl chloride (PubChem CID 19264241) has the molecular formula C14H17BrClN5O2 and a molecular weight of 402.68 g/mol. Its IUPAC name is 4-[[1-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]pyrazole-3-carbonyl]amino]butanoyl chloride.
| Compound Name | 4-[[1-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]pyrazole-3-carbonyl]amino]butanoyl chloride |
|---|---|
| PubChem CID | 19264241 |
| Molecular Formula | C14H17BrClN5O2 |
| Molecular Weight | 402.68 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | 4-[[1-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]pyrazole-3-carbonyl]amino]butanoyl chloride |
| SMILES | Cc1nn(Cn2ccc(C(=O)NCCCC(=O)Cl)n2)c(C)c1Br |
| InChI | InChI=1S/C14H17BrClN5O2/c1-9-13(15)10(2)21(18-9)8-20-7-5-11(19-20)14(23)17-6-3-4-12(16)22/h5,7H,3-4,6,8H2,1-2H3,(H,17,23) |
| InChIKey | WUEHXGJVNSPGHQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.68 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|