C18H16ClN7O — CID 19264469
N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-1-(pyrazol-1-ylmethyl)pyrazole-3-carboxamide (PubChem CID 19264469) has the molecular formula C18H16ClN7O and a molecular weight of 381.83 g/mol. Its IUPAC name is N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-1-(pyrazol-1-ylmethyl)pyrazole-3-carboxamide.
| Compound Name | N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-1-(pyrazol-1-ylmethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19264469 |
| Molecular Formula | C18H16ClN7O |
| Molecular Weight | 381.83 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-1-(pyrazol-1-ylmethyl)pyrazole-3-carboxamide |
| SMILES | O=C(Nc1ccn(Cc2ccc(Cl)cc2)n1)c1ccn(Cn2cccn2)n1 |
| InChI | InChI=1S/C18H16ClN7O/c19-15-4-2-14(3-5-15)12-24-11-7-17(23-24)21-18(27)16-6-10-26(22-16)13-25-9-1-8-20-25/h1-11H,12-13H2,(H,21,23,27) |
| InChIKey | FHESFUZERZMAOR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 82.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.83 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |