C24H32N10O6 — CID 19265062
ethyl 4-[2-[4-[[1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyrazole-3-carbonyl]amino]-3-methylpyrazol-1-yl]propanoyl]piperazine-1-carboxylate (PubChem CID 19265062) has the molecular formula C24H32N10O6 and a molecular weight of 556.58 g/mol. Its IUPAC name is ethyl 4-[2-[4-[[1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyrazole-3-carbonyl]amino]-3-methylpyrazol-1-yl]propanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[4-[[1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyrazole-3-carbonyl]amino]-3-methylpyrazol-1-yl]propanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 19265062 |
| Molecular Formula | C24H32N10O6 |
| Molecular Weight | 556.58 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | ethyl 4-[2-[4-[[1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyrazole-3-carbonyl]amino]-3-methylpyrazol-1-yl]propanoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)C(C)n2cc(NC(=O)c3ccn(Cn4nc(C)c([N+](=O)[O-])c4C)n3)c(C)n2)CC1 |
| InChI | InChI=1S/C24H32N10O6/c1-6-40-24(37)30-11-9-29(10-12-30)23(36)18(5)32-13-20(15(2)26-32)25-22(35)19-7-8-31(28-19)14-33-17(4)21(34(38)39)16(3)27-33/h7-8,13,18H,6,9-12,14H2,1-5H3,(H,25,35) |
| InChIKey | VTKLGTAESZPVFY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 175.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.58 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|