C19H13F3N4O2 — CID 19265544
N-(2-cyanophenyl)-1-[[3-(trifluoromethyl)phenoxy]methyl]pyrazole-3-carboxamide (PubChem CID 19265544) has the molecular formula C19H13F3N4O2 and a molecular weight of 386.33 g/mol. Its IUPAC name is N-(2-cyanophenyl)-1-[[3-(trifluoromethyl)phenoxy]methyl]pyrazole-3-carboxamide.
| Compound Name | N-(2-cyanophenyl)-1-[[3-(trifluoromethyl)phenoxy]methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19265544 |
| Molecular Formula | C19H13F3N4O2 |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | N-(2-cyanophenyl)-1-[[3-(trifluoromethyl)phenoxy]methyl]pyrazole-3-carboxamide |
| SMILES | N#Cc1ccccc1NC(=O)c1ccn(COc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C19H13F3N4O2/c20-19(21,22)14-5-3-6-15(10-14)28-12-26-9-8-17(25-26)18(27)24-16-7-2-1-4-13(16)11-23/h1-10H,12H2,(H,24,27) |
| InChIKey | JZURRLYPDVXWST-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |