C14H20N8O4 — CID 19265752
N-(3-morpholin-4-ylpropyl)-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide (PubChem CID 19265752) has the molecular formula C14H20N8O4 and a molecular weight of 364.37 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19265752 |
| Molecular Formula | C14H20N8O4 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)c1ccn(Cn2cnc([N+](=O)[O-])n2)n1 |
| InChI | InChI=1S/C14H20N8O4/c23-13(15-3-1-4-19-6-8-26-9-7-19)12-2-5-20(17-12)11-21-10-16-14(18-21)22(24)25/h2,5,10H,1,3-4,6-9,11H2,(H,15,23) |
| InChIKey | CBRGMGNUSYKBTK-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|