C17H13ClFN9O3 — CID 19265769
N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide (PubChem CID 19265769) has the molecular formula C17H13ClFN9O3 and a molecular weight of 445.80 g/mol. Its IUPAC name is N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide.
| Compound Name | N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19265769 |
| Molecular Formula | C17H13ClFN9O3 |
| Molecular Weight | 445.80 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide |
| SMILES | O=C(Nc1ccn(Cc2c(F)cccc2Cl)n1)c1ccn(Cn2cnc([N+](=O)[O-])n2)n1 |
| InChI | InChI=1S/C17H13ClFN9O3/c18-12-2-1-3-13(19)11(12)8-25-7-5-15(23-25)21-16(29)14-4-6-26(22-14)10-27-9-20-17(24-27)28(30)31/h1-7,9H,8,10H2,(H,21,23,29) |
| InChIKey | AYHKYBHZSDHUBC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.80 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|