C12H13N9O3 — CID 19265782
N-(1,5-dimethylpyrazol-4-yl)-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide (PubChem CID 19265782) has the molecular formula C12H13N9O3 and a molecular weight of 331.30 g/mol. Its IUPAC name is N-(1,5-dimethylpyrazol-4-yl)-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide.
| Compound Name | N-(1,5-dimethylpyrazol-4-yl)-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19265782 |
| Molecular Formula | C12H13N9O3 |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N-(1,5-dimethylpyrazol-4-yl)-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide |
| SMILES | Cc1c(NC(=O)c2ccn(Cn3cnc([N+](=O)[O-])n3)n2)cnn1C |
| InChI | InChI=1S/C12H13N9O3/c1-8-10(5-14-18(8)2)15-11(22)9-3-4-19(16-9)7-20-6-13-12(17-20)21(23)24/h3-6H,7H2,1-2H3,(H,15,22) |
| InChIKey | NNJWPXHUWWUPCS-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|