C10H13N7O3 — CID 19265794
1-[(3-nitro-1,2,4-triazol-1-yl)methyl]-N-propylpyrazole-3-carboxamide (PubChem CID 19265794) has the molecular formula C10H13N7O3 and a molecular weight of 279.26 g/mol. Its IUPAC name is 1-[(3-nitro-1,2,4-triazol-1-yl)methyl]-N-propylpyrazole-3-carboxamide.
| Compound Name | 1-[(3-nitro-1,2,4-triazol-1-yl)methyl]-N-propylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19265794 |
| Molecular Formula | C10H13N7O3 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 1-[(3-nitro-1,2,4-triazol-1-yl)methyl]-N-propylpyrazole-3-carboxamide |
| SMILES | CCCNC(=O)c1ccn(Cn2cnc([N+](=O)[O-])n2)n1 |
| InChI | InChI=1S/C10H13N7O3/c1-2-4-11-9(18)8-3-5-15(13-8)7-16-6-12-10(14-16)17(19)20/h3,5-6H,2,4,7H2,1H3,(H,11,18) |
| InChIKey | CJEYOWBNEVDOKW-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|