C20H23F3N6O4 — CID 19266082
1-(1-adamantyl)-4-nitro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]pyrazole-3-carboxamide (PubChem CID 19266082) has the molecular formula C20H23F3N6O4 and a molecular weight of 468.44 g/mol. Its IUPAC name is 1-(1-adamantyl)-4-nitro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]pyrazole-3-carboxamide.
| Compound Name | 1-(1-adamantyl)-4-nitro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19266082 |
| Molecular Formula | C20H23F3N6O4 |
| Molecular Weight | 468.44 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 1-(1-adamantyl)-4-nitro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]pyrazole-3-carboxamide |
| SMILES | O=C(Nc1cnn(COCC(F)(F)F)c1)c1nn(C23CC4CC(CC(C4)C2)C3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H23F3N6O4/c21-20(22,23)10-33-11-27-8-15(7-24-27)25-18(30)17-16(29(31)32)9-28(26-17)19-4-12-1-13(5-19)3-14(2-12)6-19/h7-9,12-14H,1-6,10-11H2,(H,25,30) |
| InChIKey | NPXOGEXSXOBPKO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 117.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|