About 2,4-dichloro-6-methoxy-1,3,5-triazine
2,4-dichloro-6-methoxy-1,3,5-triazine (PubChem CID 19267) has the molecular formula C4H3Cl2N3O
and a molecular weight of 179.99 g/mol. Its IUPAC name is 2,4-dichloro-6-methoxy-1,3,5-triazine.
Molecular Properties
| Compound Name | 2,4-dichloro-6-methoxy-1,3,5-triazine |
| PubChem CID | 19267 |
| Molecular Formula | C4H3Cl2N3O |
| Molecular Weight | 179.99 g/mol |
| Exact Mass | 178.97 |
| IUPAC Name | 2,4-dichloro-6-methoxy-1,3,5-triazine |
| SMILES | COc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C4H3Cl2N3O/c1-10-4-8-2(5)7-3(6)9-4/h1H3 |
| InChIKey | JKAPWXKZLYJQJJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.99 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-dichloro-6-methoxy-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-6-methoxy-1,3,5-triazine?
The IUPAC name of 2,4-dichloro-6-methoxy-1,3,5-triazine (CID 19267) is 2,4-dichloro-6-methoxy-1,3,5-triazine.
What is the SMILES notation for 2,4-dichloro-6-methoxy-1,3,5-triazine?
The canonical SMILES for 2,4-dichloro-6-methoxy-1,3,5-triazine is COc1nc(Cl)nc(Cl)n1.
What is the InChIKey of 2,4-dichloro-6-methoxy-1,3,5-triazine?
The InChIKey is JKAPWXKZLYJQJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3Cl2N3O/c1-10-4-8-2(5)7-3(6)9-4/h1H3.
What are the key properties of 2,4-dichloro-6-methoxy-1,3,5-triazine?
2,4-dichloro-6-methoxy-1,3,5-triazine has a molecular weight of 179.99 g/mol, XLogP of 1.19, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-6-methoxy-1,3,5-triazine is sourced from PubChem (CID 19267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).