C13H10ClF4N3O — CID 19267924
4-chloro-N-(2-fluoro-5-methylphenyl)-1-methyl-5-(trifluoromethyl)pyrazole-3-carboxamide (PubChem CID 19267924) has the molecular formula C13H10ClF4N3O and a molecular weight of 335.69 g/mol. Its IUPAC name is 4-chloro-N-(2-fluoro-5-methylphenyl)-1-methyl-5-(trifluoromethyl)pyrazole-3-carboxamide.
| Compound Name | 4-chloro-N-(2-fluoro-5-methylphenyl)-1-methyl-5-(trifluoromethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19267924 |
| Molecular Formula | C13H10ClF4N3O |
| Molecular Weight | 335.69 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 4-chloro-N-(2-fluoro-5-methylphenyl)-1-methyl-5-(trifluoromethyl)pyrazole-3-carboxamide |
| SMILES | Cc1ccc(F)c(NC(=O)c2nn(C)c(C(F)(F)F)c2Cl)c1 |
| InChI | InChI=1S/C13H10ClF4N3O/c1-6-3-4-7(15)8(5-6)19-12(22)10-9(14)11(13(16,17)18)21(2)20-10/h3-5H,1-2H3,(H,19,22) |
| InChIKey | JBLPXXIJKQPAHH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.69 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |