C13H12F3N9O4 — CID 19271610
1-[(3-nitro-1,2,4-triazol-1-yl)methyl]-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]pyrazole-3-carboxamide (PubChem CID 19271610) has the molecular formula C13H12F3N9O4 and a molecular weight of 415.29 g/mol. Its IUPAC name is 1-[(3-nitro-1,2,4-triazol-1-yl)methyl]-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]pyrazole-3-carboxamide.
| Compound Name | 1-[(3-nitro-1,2,4-triazol-1-yl)methyl]-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19271610 |
| Molecular Formula | C13H12F3N9O4 |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 1-[(3-nitro-1,2,4-triazol-1-yl)methyl]-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]pyrazole-3-carboxamide |
| SMILES | O=C(Nc1cnn(COCC(F)(F)F)c1)c1ccn(Cn2cnc([N+](=O)[O-])n2)n1 |
| InChI | InChI=1S/C13H12F3N9O4/c14-13(15,16)5-29-8-23-4-9(3-18-23)19-11(26)10-1-2-22(20-10)7-24-6-17-12(21-24)25(27)28/h1-4,6H,5,7-8H2,(H,19,26) |
| InChIKey | SDYWMNVEWHAKFA-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|