C20H25ClN6O — CID 19271947
1-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-[4-(diethylamino)phenyl]pyrazole-3-carboxamide (PubChem CID 19271947) has the molecular formula C20H25ClN6O and a molecular weight of 400.91 g/mol. Its IUPAC name is 1-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-[4-(diethylamino)phenyl]pyrazole-3-carboxamide.
| Compound Name | 1-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-[4-(diethylamino)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19271947 |
| Molecular Formula | C20H25ClN6O |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 1-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-[4-(diethylamino)phenyl]pyrazole-3-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2ccn(Cn3nc(C)c(Cl)c3C)n2)cc1 |
| InChI | InChI=1S/C20H25ClN6O/c1-5-25(6-2)17-9-7-16(8-10-17)22-20(28)18-11-12-26(24-18)13-27-15(4)19(21)14(3)23-27/h7-12H,5-6,13H2,1-4H3,(H,22,28) |
| InChIKey | KNYKIXHCUCEUEC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|