C18H20N6O4 — CID 19273181
1-ethyl-4-[[1-[(4-methoxyphenoxy)methyl]pyrazole-3-carbonyl]amino]pyrazole-3-carboxamide (PubChem CID 19273181) has the molecular formula C18H20N6O4 and a molecular weight of 384.40 g/mol. Its IUPAC name is 1-ethyl-4-[[1-[(4-methoxyphenoxy)methyl]pyrazole-3-carbonyl]amino]pyrazole-3-carboxamide.
| Compound Name | 1-ethyl-4-[[1-[(4-methoxyphenoxy)methyl]pyrazole-3-carbonyl]amino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19273181 |
| Molecular Formula | C18H20N6O4 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 1-ethyl-4-[[1-[(4-methoxyphenoxy)methyl]pyrazole-3-carbonyl]amino]pyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)c2ccn(COc3ccc(OC)cc3)n2)c(C(N)=O)n1 |
| InChI | InChI=1S/C18H20N6O4/c1-3-23-10-15(16(22-23)17(19)25)20-18(26)14-8-9-24(21-14)11-28-13-6-4-12(27-2)5-7-13/h4-10H,3,11H2,1-2H3,(H2,19,25)(H,20,26) |
| InChIKey | LKYBLHINASEODM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |