C18H26N4O3 — CID 19273294
N-[2-(diethylamino)ethyl]-1-[(4-methoxyphenoxy)methyl]pyrazole-3-carboxamide (PubChem CID 19273294) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-1-[(4-methoxyphenoxy)methyl]pyrazole-3-carboxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-1-[(4-methoxyphenoxy)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19273294 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-1-[(4-methoxyphenoxy)methyl]pyrazole-3-carboxamide |
| SMILES | CCN(CC)CCNC(=O)c1ccn(COc2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C18H26N4O3/c1-4-21(5-2)13-11-19-18(23)17-10-12-22(20-17)14-25-16-8-6-15(24-3)7-9-16/h6-10,12H,4-5,11,13-14H2,1-3H3,(H,19,23) |
| InChIKey | RJDFSYSSRCQFFX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |