C29H23N3O2S — CID 19273348
1-[(4-phenylphenoxy)methyl]-N-(2-phenylsulfanylphenyl)pyrazole-3-carboxamide (PubChem CID 19273348) has the molecular formula C29H23N3O2S and a molecular weight of 477.59 g/mol. Its IUPAC name is 1-[(4-phenylphenoxy)methyl]-N-(2-phenylsulfanylphenyl)pyrazole-3-carboxamide.
| Compound Name | 1-[(4-phenylphenoxy)methyl]-N-(2-phenylsulfanylphenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19273348 |
| Molecular Formula | C29H23N3O2S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 1-[(4-phenylphenoxy)methyl]-N-(2-phenylsulfanylphenyl)pyrazole-3-carboxamide |
| SMILES | O=C(Nc1ccccc1Sc1ccccc1)c1ccn(COc2ccc(-c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C29H23N3O2S/c33-29(30-26-13-7-8-14-28(26)35-25-11-5-2-6-12-25)27-19-20-32(31-27)21-34-24-17-15-23(16-18-24)22-9-3-1-4-10-22/h1-20H,21H2,(H,30,33) |
| InChIKey | QHKHYKYXJLEKBB-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |