C15H18ClN3O3 — CID 19276667
1-[(3-chlorophenoxy)methyl]-N-(3-methoxypropyl)pyrazole-3-carboxamide (PubChem CID 19276667) has the molecular formula C15H18ClN3O3 and a molecular weight of 323.78 g/mol. Its IUPAC name is 1-[(3-chlorophenoxy)methyl]-N-(3-methoxypropyl)pyrazole-3-carboxamide.
| Compound Name | 1-[(3-chlorophenoxy)methyl]-N-(3-methoxypropyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19276667 |
| Molecular Formula | C15H18ClN3O3 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 1-[(3-chlorophenoxy)methyl]-N-(3-methoxypropyl)pyrazole-3-carboxamide |
| SMILES | COCCCNC(=O)c1ccn(COc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C15H18ClN3O3/c1-21-9-3-7-17-15(20)14-6-8-19(18-14)11-22-13-5-2-4-12(16)10-13/h2,4-6,8,10H,3,7,9,11H2,1H3,(H,17,20) |
| InChIKey | LSNLDLRAUVTVLE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|