C13H14BrF3N6O3 — CID 19281774
3-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[2-(4-nitropyrazol-1-yl)ethyl]propanamide (PubChem CID 19281774) has the molecular formula C13H14BrF3N6O3 and a molecular weight of 439.19 g/mol. Its IUPAC name is 3-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[2-(4-nitropyrazol-1-yl)ethyl]propanamide.
| Compound Name | 3-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[2-(4-nitropyrazol-1-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 19281774 |
| Molecular Formula | C13H14BrF3N6O3 |
| Molecular Weight | 439.19 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | 3-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[2-(4-nitropyrazol-1-yl)ethyl]propanamide |
| SMILES | Cc1c(Br)c(C(F)(F)F)nn1CCC(=O)NCCn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C13H14BrF3N6O3/c1-8-11(14)12(13(15,16)17)20-22(8)4-2-10(24)18-3-5-21-7-9(6-19-21)23(25)26/h6-7H,2-5H2,1H3,(H,18,24) |
| InChIKey | MIEBLQRQNHJCAJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|