C20H26ClN7O3 — CID 19281946
3-(3-chloro-1,2,4-triazol-1-yl)-N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]adamantane-1-carboxamide (PubChem CID 19281946) has the molecular formula C20H26ClN7O3 and a molecular weight of 447.93 g/mol. Its IUPAC name is 3-(3-chloro-1,2,4-triazol-1-yl)-N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]adamantane-1-carboxamide.
| Compound Name | 3-(3-chloro-1,2,4-triazol-1-yl)-N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 19281946 |
| Molecular Formula | C20H26ClN7O3 |
| Molecular Weight | 447.93 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 3-(3-chloro-1,2,4-triazol-1-yl)-N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]adamantane-1-carboxamide |
| SMILES | Cc1nn(CCNC(=O)C23CC4CC(C2)CC(n2cnc(Cl)n2)(C4)C3)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H26ClN7O3/c1-12-16(28(30)31)13(2)26(24-12)4-3-22-17(29)19-6-14-5-15(7-19)9-20(8-14,10-19)27-11-23-18(21)25-27/h11,14-15H,3-10H2,1-2H3,(H,22,29) |
| InChIKey | MAXDKZHGJQQIJQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.93 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|