C22H29BrN6O3 — CID 19282250
2-[3-(4-bromo-3-nitropyrazol-1-yl)-1-adamantyl]-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]acetamide (PubChem CID 19282250) has the molecular formula C22H29BrN6O3 and a molecular weight of 505.42 g/mol. Its IUPAC name is 2-[3-(4-bromo-3-nitropyrazol-1-yl)-1-adamantyl]-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]acetamide.
| Compound Name | 2-[3-(4-bromo-3-nitropyrazol-1-yl)-1-adamantyl]-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]acetamide |
|---|---|
| PubChem CID | 19282250 |
| Molecular Formula | C22H29BrN6O3 |
| Molecular Weight | 505.42 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | 2-[3-(4-bromo-3-nitropyrazol-1-yl)-1-adamantyl]-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]acetamide |
| SMILES | Cc1nn(C)c(C)c1CNC(=O)CC12CC3CC(C1)CC(n1cc(Br)c([N+](=O)[O-])n1)(C3)C2 |
| InChI | InChI=1S/C22H29BrN6O3/c1-13-17(14(2)27(3)25-13)10-24-19(30)9-21-5-15-4-16(6-21)8-22(7-15,12-21)28-11-18(23)20(26-28)29(31)32/h11,15-16H,4-10,12H2,1-3H3,(H,24,30) |
| InChIKey | CUPAWSFHXHMQRG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|