C20H20ClN3O3 — CID 19283405
N-[2-(4-chloropyrazol-1-yl)ethyl]-4-[(4-methoxyphenoxy)methyl]benzamide (PubChem CID 19283405) has the molecular formula C20H20ClN3O3 and a molecular weight of 385.85 g/mol. Its IUPAC name is N-[2-(4-chloropyrazol-1-yl)ethyl]-4-[(4-methoxyphenoxy)methyl]benzamide.
| Compound Name | N-[2-(4-chloropyrazol-1-yl)ethyl]-4-[(4-methoxyphenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 19283405 |
| Molecular Formula | C20H20ClN3O3 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | N-[2-(4-chloropyrazol-1-yl)ethyl]-4-[(4-methoxyphenoxy)methyl]benzamide |
| SMILES | COc1ccc(OCc2ccc(C(=O)NCCn3cc(Cl)cn3)cc2)cc1 |
| InChI | InChI=1S/C20H20ClN3O3/c1-26-18-6-8-19(9-7-18)27-14-15-2-4-16(5-3-15)20(25)22-10-11-24-13-17(21)12-23-24/h2-9,12-13H,10-11,14H2,1H3,(H,22,25) |
| InChIKey | UPZQGWQCMNZXTL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |