C18H15Cl2N3O2 — CID 19283650
2-(4-chlorophenoxy)-N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]acetamide (PubChem CID 19283650) has the molecular formula C18H15Cl2N3O2 and a molecular weight of 376.24 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]acetamide |
|---|---|
| PubChem CID | 19283650 |
| Molecular Formula | C18H15Cl2N3O2 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1)Nc1ccn(Cc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C18H15Cl2N3O2/c19-14-3-1-13(2-4-14)11-23-10-9-17(22-23)21-18(24)12-25-16-7-5-15(20)6-8-16/h1-10H,11-12H2,(H,21,22,24) |
| InChIKey | KWJOXPFAMKUPDE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |