C24H19ClFN3O2 — CID 19285169
4-[(3-chlorophenoxy)methyl]-N-[1-[(4-fluorophenyl)methyl]pyrazol-3-yl]benzamide (PubChem CID 19285169) has the molecular formula C24H19ClFN3O2 and a molecular weight of 435.89 g/mol. Its IUPAC name is 4-[(3-chlorophenoxy)methyl]-N-[1-[(4-fluorophenyl)methyl]pyrazol-3-yl]benzamide.
| Compound Name | 4-[(3-chlorophenoxy)methyl]-N-[1-[(4-fluorophenyl)methyl]pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 19285169 |
| Molecular Formula | C24H19ClFN3O2 |
| Molecular Weight | 435.89 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 4-[(3-chlorophenoxy)methyl]-N-[1-[(4-fluorophenyl)methyl]pyrazol-3-yl]benzamide |
| SMILES | O=C(Nc1ccn(Cc2ccc(F)cc2)n1)c1ccc(COc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C24H19ClFN3O2/c25-20-2-1-3-22(14-20)31-16-18-4-8-19(9-5-18)24(30)27-23-12-13-29(28-23)15-17-6-10-21(26)11-7-17/h1-14H,15-16H2,(H,27,28,30) |
| InChIKey | RROZSFNRBZLCJY-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.89 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |