C22H21ClN4O — CID 19285296
N-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-4-(1H-indol-3-yl)butanamide (PubChem CID 19285296) has the molecular formula C22H21ClN4O and a molecular weight of 392.89 g/mol. Its IUPAC name is N-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-4-(1H-indol-3-yl)butanamide.
| Compound Name | N-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-4-(1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 19285296 |
| Molecular Formula | C22H21ClN4O |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | N-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-4-(1H-indol-3-yl)butanamide |
| SMILES | O=C(CCCc1c[nH]c2ccccc12)Nc1ccn(Cc2ccccc2Cl)n1 |
| InChI | InChI=1S/C22H21ClN4O/c23-19-9-3-1-6-17(19)15-27-13-12-21(26-27)25-22(28)11-5-7-16-14-24-20-10-4-2-8-18(16)20/h1-4,6,8-10,12-14,24H,5,7,11,15H2,(H,25,26,28) |
| InChIKey | RVENBDXLNWTUJJ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |