C34H31N3O3 — CID 19288822
(E)-N-[(1,3-diphenylpyrazol-4-yl)methyl]-3-[4-methoxy-3-[(3-methylphenoxy)methyl]phenyl]prop-2-enamide (PubChem CID 19288822) has the molecular formula C34H31N3O3 and a molecular weight of 529.64 g/mol. Its IUPAC name is (E)-N-[(1,3-diphenylpyrazol-4-yl)methyl]-3-[4-methoxy-3-[(3-methylphenoxy)methyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-[(1,3-diphenylpyrazol-4-yl)methyl]-3-[4-methoxy-3-[(3-methylphenoxy)methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 19288822 |
| Molecular Formula | C34H31N3O3 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | (E)-N-[(1,3-diphenylpyrazol-4-yl)methyl]-3-[4-methoxy-3-[(3-methylphenoxy)methyl]phenyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NCc2cn(-c3ccccc3)nc2-c2ccccc2)cc1COc1cccc(C)c1 |
| InChI | InChI=1S/C34H31N3O3/c1-25-10-9-15-31(20-25)40-24-28-21-26(16-18-32(28)39-2)17-19-33(38)35-22-29-23-37(30-13-7-4-8-14-30)36-34(29)27-11-5-3-6-12-27/h3-21,23H,22,24H2,1-2H3,(H,35,38)/b19-17+ |
| InChIKey | QFFQTKJIQXEKLN-HTXNQAPBSA-N |
| XLogP | 6.76 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|