C25H25ClN2O2 — CID 19289215
(4-benzylpiperazin-1-yl)-[3-[(2-chlorophenoxy)methyl]phenyl]methanone (PubChem CID 19289215) has the molecular formula C25H25ClN2O2 and a molecular weight of 420.94 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-[3-[(2-chlorophenoxy)methyl]phenyl]methanone.
| Compound Name | (4-benzylpiperazin-1-yl)-[3-[(2-chlorophenoxy)methyl]phenyl]methanone |
|---|---|
| PubChem CID | 19289215 |
| Molecular Formula | C25H25ClN2O2 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-[3-[(2-chlorophenoxy)methyl]phenyl]methanone |
| SMILES | O=C(c1cccc(COc2ccccc2Cl)c1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H25ClN2O2/c26-23-11-4-5-12-24(23)30-19-21-9-6-10-22(17-21)25(29)28-15-13-27(14-16-28)18-20-7-2-1-3-8-20/h1-12,17H,13-16,18-19H2 |
| InChIKey | QMBLHUSPPUMSDJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |